← Back to catalogue
Research draft

coordination complex

vr.tr.coordination-complex · PHY.OBJ

Let an agent explain coordination complexes, relay structure, bonding theories, nomenclature and applications from inorganic chemistry sources, describe the named catalysts and compounds, note handling hazards, and distinguish coordination complexes from organometallic compounds as an overlapping class, salts, chelating agents alone and alloys.

Thing Registry Physical world and living systems

Research draft, second pass

A second pass drafted this model: the structure a model of this thing needs, and what is known about it in the world. The line under this one says how the second half was obtained - researched against sources, or recalled without web access, in which case nothing here was read anywhere and every claim is a lead to verify. Unreviewed either way.

written by Claude from model knowledge without web access - no source was read, every claim is a lead to verify

Researched by: Claude

Purpose and description

Let an agent explain coordination complexes, relay structure, bonding theories, nomenclature and applications from inorganic chemistry sources, describe the named catalysts and compounds, note handling hazards, and distinguish coordination complexes from organometallic compounds as an overlapping class, salts, chelating agents alone and alloys.

A chemical species consisting of a central metal atom or ion bonded to surrounding molecules or ions called ligands, described by Alfred Werner s coordination theory, Nobel Prize 1913, found in biology as haemoglobin and chlorophyll, in medicine as cisplatin and in catalysis, including metal carbonyl hydrides and the ruthenium carbene Grubbs catalysts for olefin metathesis, whose first-generation form carries two tricyclohexylphosphine ligands, the second generation an N-heterocyclic carbene, and the Hoveyda-Grubbs variants a chelating isopropoxybenzylidene; olefin metathesis earned the 2005 Nobel Prize for Chauvin, Grubbs and Schrock.

What it is for: Catalysis, medicine, materials and biology.

It can be explain structure and bonding; relay nomenclature and applications; describe named complexes; distinguish related classes.

Distinguishing features

Metal-ligand bonds

Defined geometry

Colour and magnetism

Catalytic activity

What it looks like

Often intensely coloured crystals or solutions, depending on the metal and ligands.

Physical character

Werner Nobel Prize: 1913 year

metathesis Nobel Prize: 2005 year - Chauvin, Grubbs, Schrock

common coordination numbers: 4 and 6 list

How it is recognised

Metal centre bonded to ligands

Metal carbonyl hydride, Grubbs catalyst, first and second generation Grubbs catalysts, Hoveyda-Grubbs catalysts

Organometallics have metal-carbon bonds and overlap; salts are ionic lattices; chelators are ligands; alloys are metallic mixtures

Related models

is a kind of - in registry terms

complex

includes -

Grubbs catalyst

includes -

cisplatin

is used in -

olefin metathesis

In practice

Families and kinds

Werner-type complexes

metal carbonyls and hydrides

metal carbene catalysts

chelate complexes

bioinorganic complexes

metal-based drugs

Standards and regulation

IUPAC nomenclature of inorganic chemistry

Chemical safety regulations such as REACH

Failure modes and hazards

Toxicity of metal carbonyls and heavy metals

Treating named catalysts as synonyms

Confusing complex and organometallic classes

Also called

metal carbonyl hydrideGrubbs' catalyst(1,3-dimesitylimidazolidin-2-ylidene)(tricyclohexylphosphine)benzylidene ruthenium dichloridebis(tricyclohexylphosphine)benzylidene ruthenium(IV) dichloride[1,3-Bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(2-isopropoxyphenylmethylene)rutheniumdichloro(2-isopropoxyphenylmethylene)(tricyclohexylphosphine)ruthenium(II)coordination polymertransition metal nitrate complexalkaline earth octacarbonyl complexmetal ammine complexacidomanganate(IV) complexchloroanionpromethocenepentachloromanganatebis(methylcyclopentadienyl)manganesechromyl chloridediamminesilver(1+)tetraammineaquacopper(2+)amminepentacyanoferrate(3-)diamminemercury(2+)transition metal dithiocarbamate complexiron coordination entityiron carbonylsmagnesium coordination compoundantimony coordination compoundTransition metal chloride complexKeggin structuretransition metal oxalate complexmagnesium porphyrinMetal complexes of diaminestricarbonyl(cyclopentadienyl)hydridochromiummetalloporphyrinsphosphomolybdate iontransition metal alkyl complexcyclopentadienyl complexsandwich compoundmagnesium protoporphyrin(2-)f-block metallocenebent metallocenetransition metal imidazole complex

+52

Where this came from

wikidata · CC0 1.0

Source repository Registry entry point

Drafted structure

Bundle to layer to finding to question, as the second pass will find it: 4 bundles · 8 layers · 8 findings · 16 questions.

Understand What a coordination complex is.

Science.

Definition

Definition.

Definition

Definition.

  1. What is a coordination complex, and how does it differ from organometallics, salts, chelators and alloys? definition
  2. Is the question about chemistry theory, a catalyst, a drug or safety? boundary

Named

Named complexes.

Named

Named.

  1. What are metal carbonyl hydrides and the first-generation, second-generation and Hoveyda-Grubbs catalysts? definition
  2. Which entry fits the specific complex? action
Chemistry Structure and bonding.

Science.

Bonding

Bonding theories.

Bonding

Bonding.

  1. How do crystal field and ligand field theories explain colour and magnetism? provenance
  2. Which references are standard? provenance

Nomenclature

Nomenclature.

Nomenclature

Nomenclature.

  1. How are complexes named under IUPAC rules? provenance
  2. Which sources are cited? provenance
Applications Applications.

Regulation.

Catalysis

Metathesis.

Catalysis

Catalysis.

  1. How do Grubbs catalysts perform olefin metathesis, and why was it Nobel-winning? provenance
  2. Which entry fits olefin metathesis? action

Medicine

Metal drugs.

Medicine

Medicine.

  1. How do platinum complexes such as cisplatin treat cancer? provenance
  2. Which entry fits cisplatin? action
Context Biology and history.

Context.

Biology

Bioinorganic.

Biology

Biology.

  1. How do haemoglobin and chlorophyll use metal complexes? provenance
  2. Which entry fits bioinorganic chemistry? action

History

History.

History

History.

  1. How did Werner overturn chain theories of complexes? provenance
  2. Which entry fits Alfred Werner? action

What the second pass must settle

  • Should the Grubbs catalyst generations be separate entries?
  • How should inorganic chemistry sources be linked?
  • The registry entry has merged aliases naming specific catalysts; should they be split off?
Draft as JSON